C14H15F3N4O3S — CID 166376567
N-[2-(benzenesulfonamido)ethyl]-4-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 166376567) has the molecular formula C14H15F3N4O3S and a molecular weight of 376.36 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)ethyl]-4-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[2-(benzenesulfonamido)ethyl]-4-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166376567 |
| Molecular Formula | C14H15F3N4O3S |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-[2-(benzenesulfonamido)ethyl]-4-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCNS(=O)(=O)c2ccccc2)n[nH]c1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N4O3S/c1-9-11(20-21-12(9)14(15,16)17)13(22)18-7-8-19-25(23,24)10-5-3-2-4-6-10/h2-6,19H,7-8H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | QPNOODVWFVYWIG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|