C16H26N2O5S — CID 166376672
1-(3,5-dihydroxyadamantane-1-carbonyl)-N-methylpyrrolidine-3-sulfonamide (PubChem CID 166376672) has the molecular formula C16H26N2O5S and a molecular weight of 358.46 g/mol. Its IUPAC name is 1-(3,5-dihydroxyadamantane-1-carbonyl)-N-methylpyrrolidine-3-sulfonamide.
| Compound Name | 1-(3,5-dihydroxyadamantane-1-carbonyl)-N-methylpyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 166376672 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-(3,5-dihydroxyadamantane-1-carbonyl)-N-methylpyrrolidine-3-sulfonamide |
| SMILES | CNS(=O)(=O)C1CCN(C(=O)C23CC4CC(O)(CC(O)(C4)C2)C3)C1 |
| InChI | InChI=1S/C16H26N2O5S/c1-17-24(22,23)12-2-3-18(7-12)13(19)14-4-11-5-15(20,8-14)10-16(21,6-11)9-14/h11-12,17,20-21H,2-10H2,1H3 |
| InChIKey | SPFHLEQNPRDXKV-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |