C24H31N5O3S — CID 166379646
N'-[1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]ethyl]-N-(6-propan-2-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxamide (PubChem CID 166379646) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is N'-[1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]ethyl]-N-(6-propan-2-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxamide.
| Compound Name | N'-[1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]ethyl]-N-(6-propan-2-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 166379646 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N'-[1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]ethyl]-N-(6-propan-2-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxamide |
| SMILES | CC(NC(=O)C(=O)Nc1nc2c(s1)CC(C(C)C)CC2)c1ccc(N2CCCNC2=O)cc1 |
| InChI | InChI=1S/C24H31N5O3S/c1-14(2)17-7-10-19-20(13-17)33-23(27-19)28-22(31)21(30)26-15(3)16-5-8-18(9-6-16)29-12-4-11-25-24(29)32/h5-6,8-9,14-15,17H,4,7,10-13H2,1-3H3,(H,25,32)(H,26,30)(H,27,28,31) |
| InChIKey | ALYRDGHUGZNUBN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|