C22H32N2O3 — CID 166380727
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-[4-[[(3R)-morpholin-3-yl]methyl]phenoxy]acetamide (PubChem CID 166380727) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-[4-[[(3R)-morpholin-3-yl]methyl]phenoxy]acetamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-[4-[[(3R)-morpholin-3-yl]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 166380727 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-[4-[[(3R)-morpholin-3-yl]methyl]phenoxy]acetamide |
| SMILES | CC(NC(=O)COc1ccc(C[C@@H]2COCCN2)cc1)C1CC2CCC1C2 |
| InChI | InChI=1S/C22H32N2O3/c1-15(21-12-17-2-5-18(21)10-17)24-22(25)14-27-20-6-3-16(4-7-20)11-19-13-26-9-8-23-19/h3-4,6-7,15,17-19,21,23H,2,5,8-14H2,1H3,(H,24,25)/t15?,17?,18?,19-,21?/m1/s1 |
| InChIKey | RXQHEUKVRBCORN-ZBLKZYTESA-N |
| XLogP | 2.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |