C20H17ClN2 — CID 16638355
N-(4-chlorophenyl)-1-(2,5-dimethylphenyl)-1-pyridin-4-ylmethanimine (PubChem CID 16638355) has the molecular formula C20H17ClN2 and a molecular weight of 320.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-(2,5-dimethylphenyl)-1-pyridin-4-ylmethanimine.
| Compound Name | N-(4-chlorophenyl)-1-(2,5-dimethylphenyl)-1-pyridin-4-ylmethanimine |
|---|---|
| PubChem CID | 16638355 |
| Molecular Formula | C20H17ClN2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-(4-chlorophenyl)-1-(2,5-dimethylphenyl)-1-pyridin-4-ylmethanimine |
| SMILES | Cc1ccc(C)c(/C(=N/c2ccc(Cl)cc2)c2ccncc2)c1 |
| InChI | InChI=1S/C20H17ClN2/c1-14-3-4-15(2)19(13-14)20(16-9-11-22-12-10-16)23-18-7-5-17(21)6-8-18/h3-13H,1-2H3/b23-20+ |
| InChIKey | ACYXBZCZNHHDCQ-BSYVCWPDSA-N |
| XLogP | 5.52 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|