C16H23N3O5 — CID 166387014
methyl (2R)-3-methyl-2-[[2-[[2-(pyridin-4-ylmethoxy)acetyl]amino]acetyl]amino]butanoate (PubChem CID 166387014) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl (2R)-3-methyl-2-[[2-[[2-(pyridin-4-ylmethoxy)acetyl]amino]acetyl]amino]butanoate.
| Compound Name | methyl (2R)-3-methyl-2-[[2-[[2-(pyridin-4-ylmethoxy)acetyl]amino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 166387014 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | methyl (2R)-3-methyl-2-[[2-[[2-(pyridin-4-ylmethoxy)acetyl]amino]acetyl]amino]butanoate |
| SMILES | COC(=O)[C@H](NC(=O)CNC(=O)COCc1ccncc1)C(C)C |
| InChI | InChI=1S/C16H23N3O5/c1-11(2)15(16(22)23-3)19-13(20)8-18-14(21)10-24-9-12-4-6-17-7-5-12/h4-7,11,15H,8-10H2,1-3H3,(H,18,21)(H,19,20)/t15-/m1/s1 |
| InChIKey | XIVUKGAUILKIJT-OAHLLOKOSA-N |
| XLogP | 0.03 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |