C15H10ClNO3S — CID 16638853
5-chloro-2-oxo-3-(thiophene-2-carbonyl)-1,3-dihydroindene-1-carboxamide (PubChem CID 16638853) has the molecular formula C15H10ClNO3S and a molecular weight of 319.77 g/mol. Its IUPAC name is 5-chloro-2-oxo-3-(thiophene-2-carbonyl)-1,3-dihydroindene-1-carboxamide.
| Compound Name | 5-chloro-2-oxo-3-(thiophene-2-carbonyl)-1,3-dihydroindene-1-carboxamide |
|---|---|
| PubChem CID | 16638853 |
| Molecular Formula | C15H10ClNO3S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 5-chloro-2-oxo-3-(thiophene-2-carbonyl)-1,3-dihydroindene-1-carboxamide |
| SMILES | NC(=O)C1C(=O)C(C(=O)c2cccs2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H10ClNO3S/c16-7-3-4-8-9(6-7)11(14(19)12(8)15(17)20)13(18)10-2-1-5-21-10/h1-6,11-12H,(H2,17,20) |
| InChIKey | MCEDJCCQWFQNGW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|