C16H11Cl2NO4S — CID 67702358
2-chloroethyl 5-chloro-2-oxo-3-(thiophene-2-carbonyl)-3H-indole-1-carboxylate (PubChem CID 67702358) has the molecular formula C16H11Cl2NO4S and a molecular weight of 384.24 g/mol. Its IUPAC name is 2-chloroethyl 5-chloro-2-oxo-3-(thiophene-2-carbonyl)-3H-indole-1-carboxylate.
| Compound Name | 2-chloroethyl 5-chloro-2-oxo-3-(thiophene-2-carbonyl)-3H-indole-1-carboxylate |
|---|---|
| PubChem CID | 67702358 |
| Molecular Formula | C16H11Cl2NO4S |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 2-chloroethyl 5-chloro-2-oxo-3-(thiophene-2-carbonyl)-3H-indole-1-carboxylate |
| SMILES | O=C(c1cccs1)C1C(=O)N(C(=O)OCCCl)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H11Cl2NO4S/c17-5-6-23-16(22)19-11-4-3-9(18)8-10(11)13(15(19)21)14(20)12-2-1-7-24-12/h1-4,7-8,13H,5-6H2 |
| InChIKey | XGUUIJJLLWYQAS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|