C21H14ClNO5S — CID 139623149
6-chloro-1-(3,4-dihydroxybenzoyl)-3-(thiophene-2-carbonyl)-3,4-dihydroquinolin-2-one (PubChem CID 139623149) has the molecular formula C21H14ClNO5S and a molecular weight of 427.87 g/mol. Its IUPAC name is 6-chloro-1-(3,4-dihydroxybenzoyl)-3-(thiophene-2-carbonyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 6-chloro-1-(3,4-dihydroxybenzoyl)-3-(thiophene-2-carbonyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 139623149 |
| Molecular Formula | C21H14ClNO5S |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 6-chloro-1-(3,4-dihydroxybenzoyl)-3-(thiophene-2-carbonyl)-3,4-dihydroquinolin-2-one |
| SMILES | O=C(c1cccs1)C1Cc2cc(Cl)ccc2N(C(=O)c2ccc(O)c(O)c2)C1=O |
| InChI | InChI=1S/C21H14ClNO5S/c22-13-4-5-15-12(8-13)9-14(19(26)18-2-1-7-29-18)21(28)23(15)20(27)11-3-6-16(24)17(25)10-11/h1-8,10,14,24-25H,9H2 |
| InChIKey | TWPMJBAYLINBJL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|