C18H17ClN3O3S+ — CID 9330957
5-chloro-1-[[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]methyl]indole-2,3-dione (PubChem CID 9330957) has the molecular formula C18H17ClN3O3S+ and a molecular weight of 390.87 g/mol. Its IUPAC name is 5-chloro-1-[[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]methyl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 9330957 |
| Molecular Formula | C18H17ClN3O3S+ |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 5-chloro-1-[[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(C[NH+]2CCN(C(=O)c3cccs3)CC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H16ClN3O3S/c19-12-3-4-14-13(10-12)16(23)18(25)22(14)11-20-5-7-21(8-6-20)17(24)15-2-1-9-26-15/h1-4,9-10H,5-8,11H2/p+1 |
| InChIKey | DOAWUQXTSQAVJI-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|