C20H25N4OS2+ — CID 9331213
[4-[(3-propan-2-yl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazin-4-ium-1-yl]-thiophen-2-ylmethanone (PubChem CID 9331213) has the molecular formula C20H25N4OS2+ and a molecular weight of 401.58 g/mol. Its IUPAC name is [4-[(3-propan-2-yl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazin-4-ium-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[(3-propan-2-yl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazin-4-ium-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 9331213 |
| Molecular Formula | C20H25N4OS2+ |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [4-[(3-propan-2-yl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazin-4-ium-1-yl]-thiophen-2-ylmethanone |
| SMILES | CC(C)n1c(=S)n(C[NH+]2CCN(C(=O)c3cccs3)CC2)c2ccccc21 |
| InChI | InChI=1S/C20H24N4OS2/c1-15(2)24-17-7-4-3-6-16(17)23(20(24)26)14-21-9-11-22(12-10-21)19(25)18-8-5-13-27-18/h3-8,13,15H,9-12,14H2,1-2H3/p+1 |
| InChIKey | ZNBCIJLKFIUPEL-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 34.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|