C9H13N3O2S — CID 166390592
5-amino-3-ethyl-N-(oxetan-3-yl)-1,2-thiazole-4-carboxamide (PubChem CID 166390592) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 5-amino-3-ethyl-N-(oxetan-3-yl)-1,2-thiazole-4-carboxamide.
| Compound Name | 5-amino-3-ethyl-N-(oxetan-3-yl)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 166390592 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 5-amino-3-ethyl-N-(oxetan-3-yl)-1,2-thiazole-4-carboxamide |
| SMILES | CCc1nsc(N)c1C(=O)NC1COC1 |
| InChI | InChI=1S/C9H13N3O2S/c1-2-6-7(8(10)15-12-6)9(13)11-5-3-14-4-5/h5H,2-4,10H2,1H3,(H,11,13) |
| InChIKey | AFMVJLMRDSMJDX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |