C15H14ClN2O+ — CID 166392235
1-(3-chlorophenyl)-2-methyl-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-3-one (PubChem CID 166392235) has the molecular formula C15H14ClN2O+ and a molecular weight of 273.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-methyl-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-3-one.
| Compound Name | 1-(3-chlorophenyl)-2-methyl-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-3-one |
|---|---|
| PubChem CID | 166392235 |
| Molecular Formula | C15H14ClN2O+ |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 1-(3-chlorophenyl)-2-methyl-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-3-one |
| SMILES | CN1C(=O)C[n+]2ccccc2C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H14ClN2O/c1-17-14(19)10-18-8-3-2-7-13(18)15(17)11-5-4-6-12(16)9-11/h2-9,15H,10H2,1H3/q+1 |
| InChIKey | YOULAEQBTBEHFS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|