C11H12ClNO3S — CID 24846655
2-(3-chlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one (PubChem CID 24846655) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one.
| Compound Name | 2-(3-chlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 24846655 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-(3-chlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one |
| SMILES | CN1C(=O)CCS(=O)(=O)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H12ClNO3S/c1-13-10(14)5-6-17(15,16)11(13)8-3-2-4-9(12)7-8/h2-4,7,11H,5-6H2,1H3 |
| InChIKey | OWLQIYLAAQSFIX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |