C19H17NO5S — CID 166397272
4-but-3-enyl-N-(4-hydroxy-2-oxochromen-6-yl)benzenesulfonamide (PubChem CID 166397272) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is 4-but-3-enyl-N-(4-hydroxy-2-oxochromen-6-yl)benzenesulfonamide.
| Compound Name | 4-but-3-enyl-N-(4-hydroxy-2-oxochromen-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 166397272 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 4-but-3-enyl-N-(4-hydroxy-2-oxochromen-6-yl)benzenesulfonamide |
| SMILES | C=CCCc1ccc(S(=O)(=O)Nc2ccc3oc(=O)cc(O)c3c2)cc1 |
| InChI | InChI=1S/C19H17NO5S/c1-2-3-4-13-5-8-15(9-6-13)26(23,24)20-14-7-10-18-16(11-14)17(21)12-19(22)25-18/h2,5-12,20-21H,1,3-4H2 |
| InChIKey | HGUZEKLGTNARAF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|