C19H12BrNO6S — CID 141478539
4-bromo-N-(6,8-dihydroxy-9-oxoxanthen-2-yl)benzenesulfonamide (PubChem CID 141478539) has the molecular formula C19H12BrNO6S and a molecular weight of 462.28 g/mol. Its IUPAC name is 4-bromo-N-(6,8-dihydroxy-9-oxoxanthen-2-yl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(6,8-dihydroxy-9-oxoxanthen-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 141478539 |
| Molecular Formula | C19H12BrNO6S |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 460.96 |
| IUPAC Name | 4-bromo-N-(6,8-dihydroxy-9-oxoxanthen-2-yl)benzenesulfonamide |
| SMILES | O=c1c2cc(NS(=O)(=O)c3ccc(Br)cc3)ccc2oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C19H12BrNO6S/c20-10-1-4-13(5-2-10)28(25,26)21-11-3-6-16-14(7-11)19(24)18-15(23)8-12(22)9-17(18)27-16/h1-9,21-23H |
| InChIKey | IULMZFJYODWBRV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|