C15H16ClF3N4OSi — CID 166399067
6-chloro-N-(pyrimidin-2-ylmethyl)-2-(trifluoromethyl)-5-trimethylsilylpyridine-3-carboxamide (PubChem CID 166399067) has the molecular formula C15H16ClF3N4OSi and a molecular weight of 388.85 g/mol. Its IUPAC name is 6-chloro-N-(pyrimidin-2-ylmethyl)-2-(trifluoromethyl)-5-trimethylsilylpyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(pyrimidin-2-ylmethyl)-2-(trifluoromethyl)-5-trimethylsilylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 166399067 |
| Molecular Formula | C15H16ClF3N4OSi |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 6-chloro-N-(pyrimidin-2-ylmethyl)-2-(trifluoromethyl)-5-trimethylsilylpyridine-3-carboxamide |
| SMILES | C[Si](C)(C)c1cc(C(=O)NCc2ncccn2)c(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C15H16ClF3N4OSi/c1-25(2,3)10-7-9(12(15(17,18)19)23-13(10)16)14(24)22-8-11-20-5-4-6-21-11/h4-7H,8H2,1-3H3,(H,22,24) |
| InChIKey | IKGJNWNWLHNRAV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|