C9H10Cl2F5N5O — CID 166399540
5-[chloro(difluoro)methyl]-N-(diaminomethylidene)-1-ethyl-3-(trifluoromethyl)pyrazole-4-carboxamide;hydrochloride (PubChem CID 166399540) has the molecular formula C9H10Cl2F5N5O and a molecular weight of 370.11 g/mol. Its IUPAC name is 5-[chloro(difluoro)methyl]-N-(diaminomethylidene)-1-ethyl-3-(trifluoromethyl)pyrazole-4-carboxamide;hydrochloride.
| Compound Name | 5-[chloro(difluoro)methyl]-N-(diaminomethylidene)-1-ethyl-3-(trifluoromethyl)pyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 166399540 |
| Molecular Formula | C9H10Cl2F5N5O |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 5-[chloro(difluoro)methyl]-N-(diaminomethylidene)-1-ethyl-3-(trifluoromethyl)pyrazole-4-carboxamide;hydrochloride |
| SMILES | CCn1nc(C(F)(F)F)c(C(=O)N=C(N)N)c1C(F)(F)Cl.Cl |
| InChI | InChI=1S/C9H9ClF5N5O.ClH/c1-2-20-5(8(10,11)12)3(6(21)18-7(16)17)4(19-20)9(13,14)15;/h2H2,1H3,(H4,16,17,18,21);1H |
| InChIKey | PUFPITOQRGJIEX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|