C20H14F2N2O4 — CID 166405163
7-fluoro-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-4-methyl-2-oxochromene-3-carboxamide (PubChem CID 166405163) has the molecular formula C20H14F2N2O4 and a molecular weight of 384.34 g/mol. Its IUPAC name is 7-fluoro-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-4-methyl-2-oxochromene-3-carboxamide.
| Compound Name | 7-fluoro-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-4-methyl-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 166405163 |
| Molecular Formula | C20H14F2N2O4 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 7-fluoro-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-4-methyl-2-oxochromene-3-carboxamide |
| SMILES | C=CC(=O)Nc1cc(NC(=O)c2c(C)c3ccc(F)cc3oc2=O)ccc1F |
| InChI | InChI=1S/C20H14F2N2O4/c1-3-17(25)24-15-9-12(5-7-14(15)22)23-19(26)18-10(2)13-6-4-11(21)8-16(13)28-20(18)27/h3-9H,1H2,2H3,(H,23,26)(H,24,25) |
| InChIKey | VSFPSVUYZLKUKI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|