C13H10N4O3 — CID 166405193
methyl 4-[(2-cyanopyridine-4-carbonyl)amino]-1H-pyrrole-2-carboxylate (PubChem CID 166405193) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is methyl 4-[(2-cyanopyridine-4-carbonyl)amino]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[(2-cyanopyridine-4-carbonyl)amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166405193 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | methyl 4-[(2-cyanopyridine-4-carbonyl)amino]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccnc(C#N)c2)c[nH]1 |
| InChI | InChI=1S/C13H10N4O3/c1-20-13(19)11-5-10(7-16-11)17-12(18)8-2-3-15-9(4-8)6-14/h2-5,7,16H,1H3,(H,17,18) |
| InChIKey | YKBUKICIASVZAH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |