About methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate
methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate (PubChem CID 166407985) has the molecular formula C10H12ClN3O3
and a molecular weight of 257.68 g/mol. Its IUPAC name is methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate |
| PubChem CID | 166407985 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate |
| SMILES | COC(=O)c1cnn2c1CN(C(=O)CCl)CC2 |
| InChI | InChI=1S/C10H12ClN3O3/c1-17-10(16)7-5-12-14-3-2-13(6-8(7)14)9(15)4-11/h5H,2-4,6H2,1H3 |
| InChIKey | UOWKCXRVZHGTBW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate?
The IUPAC name of methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate (CID 166407985) is methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate.
What is the SMILES notation for methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate?
The canonical SMILES for methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate is COC(=O)c1cnn2c1CN(C(=O)CCl)CC2.
What is the InChIKey of methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate?
The InChIKey is UOWKCXRVZHGTBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3O3/c1-17-10(16)7-5-12-14-3-2-13(6-8(7)14)9(15)4-11/h5H,2-4,6H2,1H3.
What are the key properties of methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate?
methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate has a molecular weight of 257.68 g/mol, XLogP of 0.25, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2-chloroacetyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylate is sourced from PubChem (CID 166407985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).