About 3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid
3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid (PubChem CID 150811241) has the molecular formula C7H10N4O2
and a molecular weight of 182.18 g/mol. Its IUPAC name is 3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid.
Analyze 3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid?
The IUPAC name of 3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid (CID 150811241) is 3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid.
What is the SMILES notation for 3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid?
The canonical SMILES for 3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid is Nc1cnn2c1CN(C(=O)O)CC2.
What is the InChIKey of 3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid?
The InChIKey is KHYAUDXMZLNZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c8-5-3-9-11-2-1-10(7(12)13)4-6(5)11/h3H,1-2,4,8H2,(H,12,13).
What are the key properties of 3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid?
3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid has a molecular weight of 182.18 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid is sourced from PubChem (CID 150811241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).