C19H22N2O3 — CID 166411654
N-[2-[[(1S)-3-hydroxy-1-naphthalen-1-ylpropyl]amino]-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 166411654) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[2-[[(1S)-3-hydroxy-1-naphthalen-1-ylpropyl]amino]-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | N-[2-[[(1S)-3-hydroxy-1-naphthalen-1-ylpropyl]amino]-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 166411654 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[2-[[(1S)-3-hydroxy-1-naphthalen-1-ylpropyl]amino]-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(=O)N[C@@H](CCO)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H22N2O3/c1-3-19(24)21(2)13-18(23)20-17(11-12-22)16-10-6-8-14-7-4-5-9-15(14)16/h3-10,17,22H,1,11-13H2,2H3,(H,20,23)/t17-/m0/s1 |
| InChIKey | OPKSFPKYBZVYKG-KRWDZBQOSA-N |
| XLogP | 2.02 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|