C17H17N3O4S — CID 166412063
N-[3-[(3aR,6aR)-3a-cyano-2,2-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carbonyl]phenyl]prop-2-enamide (PubChem CID 166412063) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is N-[3-[(3aR,6aR)-3a-cyano-2,2-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[(3aR,6aR)-3a-cyano-2,2-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166412063 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[3-[(3aR,6aR)-3a-cyano-2,2-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(C(=O)N2C[C@@H]3CS(=O)(=O)C[C@@]3(C#N)C2)c1 |
| InChI | InChI=1S/C17H17N3O4S/c1-2-15(21)19-14-5-3-4-12(6-14)16(22)20-7-13-8-25(23,24)11-17(13,9-18)10-20/h2-6,13H,1,7-8,10-11H2,(H,19,21)/t13-,17-/m1/s1 |
| InChIKey | UANYOZAYALDDIC-CXAGYDPISA-N |
| XLogP | 0.82 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|