C21H23F3N2O2 — CID 166413105
1-[3-[4-[2-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 166413105) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is 1-[3-[4-[2-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-[2-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166413105 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[3-[4-[2-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(C(=O)N2CC=C(c3ccccc3C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C21H23F3N2O2/c1-2-19(27)26-11-5-6-16(14-26)20(28)25-12-9-15(10-13-25)17-7-3-4-8-18(17)21(22,23)24/h2-4,7-9,16H,1,5-6,10-14H2 |
| InChIKey | WTQOOYKMYDOOKX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|