C21H23F3N2O4 — CID 166413088
methyl 2-(1-prop-2-enoylpiperidine-3-carbonyl)-8-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-4-carboxylate (PubChem CID 166413088) has the molecular formula C21H23F3N2O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is methyl 2-(1-prop-2-enoylpiperidine-3-carbonyl)-8-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-4-carboxylate.
| Compound Name | methyl 2-(1-prop-2-enoylpiperidine-3-carbonyl)-8-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 166413088 |
| Molecular Formula | C21H23F3N2O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | methyl 2-(1-prop-2-enoylpiperidine-3-carbonyl)-8-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-4-carboxylate |
| SMILES | C=CC(=O)N1CCCC(C(=O)N2Cc3c(cccc3C(F)(F)F)C(C(=O)OC)C2)C1 |
| InChI | InChI=1S/C21H23F3N2O4/c1-3-18(27)25-9-5-6-13(10-25)19(28)26-11-15-14(16(12-26)20(29)30-2)7-4-8-17(15)21(22,23)24/h3-4,7-8,13,16H,1,5-6,9-12H2,2H3 |
| InChIKey | MQXZEZKGHFFMAE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|