C23H24N2O4 — CID 166413366
N-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 166413366) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | N-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 166413366 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | C=CC(=O)N1CCCc2cc(C(=O)NC3CCOc4c(OC)cccc43)ccc21 |
| InChI | InChI=1S/C23H24N2O4/c1-3-21(26)25-12-5-6-15-14-16(9-10-19(15)25)23(27)24-18-11-13-29-22-17(18)7-4-8-20(22)28-2/h3-4,7-10,14,18H,1,5-6,11-13H2,2H3,(H,24,27) |
| InChIKey | QYWIUJFYUPXSBA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|