C12H10ClF6NO — CID 166414663
2-chloro-N-methyl-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 166414663) has the molecular formula C12H10ClF6NO and a molecular weight of 333.66 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | 2-chloro-N-methyl-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 166414663 |
| Molecular Formula | C12H10ClF6NO |
| Molecular Weight | 333.66 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 2-chloro-N-methyl-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | CN(C(=O)CCl)C(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C12H10ClF6NO/c1-20(9(21)6-13)10(12(17,18)19)7-3-2-4-8(5-7)11(14,15)16/h2-5,10H,6H2,1H3 |
| InChIKey | APKZGHATZLTTHD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|