C15H22F2N2O2 — CID 166415712
6,6-difluoro-N-[2-(prop-2-enoylamino)ethyl]-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxamide (PubChem CID 166415712) has the molecular formula C15H22F2N2O2 and a molecular weight of 300.35 g/mol. Its IUPAC name is 6,6-difluoro-N-[2-(prop-2-enoylamino)ethyl]-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxamide.
| Compound Name | 6,6-difluoro-N-[2-(prop-2-enoylamino)ethyl]-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxamide |
|---|---|
| PubChem CID | 166415712 |
| Molecular Formula | C15H22F2N2O2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 6,6-difluoro-N-[2-(prop-2-enoylamino)ethyl]-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxamide |
| SMILES | C=CC(=O)NCCNC(=O)C12CCCC1CC(F)(F)CC2 |
| InChI | InChI=1S/C15H22F2N2O2/c1-2-12(20)18-8-9-19-13(21)14-5-3-4-11(14)10-15(16,17)7-6-14/h2,11H,1,3-10H2,(H,18,20)(H,19,21) |
| InChIKey | IJOXDBURTGXFHP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|