C22H31N3O3 — CID 166420750
N-(cyclohexylmethyl)-2-methyl-2-[[2-[2-(prop-2-enoylamino)phenyl]acetyl]amino]propanamide (PubChem CID 166420750) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-methyl-2-[[2-[2-(prop-2-enoylamino)phenyl]acetyl]amino]propanamide.
| Compound Name | N-(cyclohexylmethyl)-2-methyl-2-[[2-[2-(prop-2-enoylamino)phenyl]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 166420750 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-(cyclohexylmethyl)-2-methyl-2-[[2-[2-(prop-2-enoylamino)phenyl]acetyl]amino]propanamide |
| SMILES | C=CC(=O)Nc1ccccc1CC(=O)NC(C)(C)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C22H31N3O3/c1-4-19(26)24-18-13-9-8-12-17(18)14-20(27)25-22(2,3)21(28)23-15-16-10-6-5-7-11-16/h4,8-9,12-13,16H,1,5-7,10-11,14-15H2,2-3H3,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | JJRCFPSIEDTDEM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|