C15H23ClN2O3 — CID 166423655
2-chloro-N-[(3,3-dimethyloxolan-2-yl)methyl]-N-[(5-ethyl-1,2-oxazol-3-yl)methyl]acetamide (PubChem CID 166423655) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is 2-chloro-N-[(3,3-dimethyloxolan-2-yl)methyl]-N-[(5-ethyl-1,2-oxazol-3-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(3,3-dimethyloxolan-2-yl)methyl]-N-[(5-ethyl-1,2-oxazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 166423655 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-chloro-N-[(3,3-dimethyloxolan-2-yl)methyl]-N-[(5-ethyl-1,2-oxazol-3-yl)methyl]acetamide |
| SMILES | CCc1cc(CN(CC2OCCC2(C)C)C(=O)CCl)no1 |
| InChI | InChI=1S/C15H23ClN2O3/c1-4-12-7-11(17-21-12)9-18(14(19)8-16)10-13-15(2,3)5-6-20-13/h7,13H,4-6,8-10H2,1-3H3 |
| InChIKey | WXGXFTSMSREWQR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|