C16H18FN3O4S2 — CID 166424932
3-[2-[[1-(4-fluoro-3-methoxyphenyl)pyrazole-3-carbonyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166424932) has the molecular formula C16H18FN3O4S2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-[2-[[1-(4-fluoro-3-methoxyphenyl)pyrazole-3-carbonyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[1-(4-fluoro-3-methoxyphenyl)pyrazole-3-carbonyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166424932 |
| Molecular Formula | C16H18FN3O4S2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 3-[2-[[1-(4-fluoro-3-methoxyphenyl)pyrazole-3-carbonyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | COc1cc(-n2ccc(C(=O)NCCSSCCC(=O)O)n2)ccc1F |
| InChI | InChI=1S/C16H18FN3O4S2/c1-24-14-10-11(2-3-12(14)17)20-7-4-13(19-20)16(23)18-6-9-26-25-8-5-15(21)22/h2-4,7,10H,5-6,8-9H2,1H3,(H,18,23)(H,21,22) |
| InChIKey | YKIIHHQXPUDMGO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|