C24H24N4O5 — CID 166426751
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-phenylmorpholine-4-carboxamide (PubChem CID 166426751) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-phenylmorpholine-4-carboxamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-phenylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 166426751 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-phenylmorpholine-4-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(NC(=O)N4CCOCC4c4ccccc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H24N4O5/c29-21-9-8-19(22(30)26-21)28-13-16-12-17(6-7-18(16)23(28)31)25-24(32)27-10-11-33-14-20(27)15-4-2-1-3-5-15/h1-7,12,19-20H,8-11,13-14H2,(H,25,32)(H,26,29,30) |
| InChIKey | HXILAKIEBOOAGK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|