C23H19F3N4O4 — CID 175968705
(2R)-N-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]-2-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide (PubChem CID 175968705) has the molecular formula C23H19F3N4O4 and a molecular weight of 472.42 g/mol. Its IUPAC name is (2R)-N-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]-2-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | (2R)-N-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]-2-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 175968705 |
| Molecular Formula | C23H19F3N4O4 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (2R)-N-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]-2-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide |
| SMILES | O=C1CC[C@H](N2Cc3cc(NC(=O)N4c5ccccc5C[C@@H]4C(F)(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H19F3N4O4/c24-23(25,26)18-10-12-3-1-2-4-16(12)30(18)22(34)27-14-5-6-15-13(9-14)11-29(21(15)33)17-7-8-19(31)28-20(17)32/h1-6,9,17-18H,7-8,10-11H2,(H,27,34)(H,28,31,32)/t17-,18+/m0/s1 |
| InChIKey | XVXAAICWIODLGA-ZWKOTPCHSA-N |
| XLogP | 2.97 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|