C23H21FN4O4 — CID 176766825
N-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]-2-methyl-2,3-dihydroindole-1-carboxamide (PubChem CID 176766825) has the molecular formula C23H21FN4O4 and a molecular weight of 436.44 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]-2-methyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]-2-methyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 176766825 |
| Molecular Formula | C23H21FN4O4 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]-2-methyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CC1Cc2ccccc2N1C(=O)Nc1cc2c(cc1F)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C23H21FN4O4/c1-12-8-13-4-2-3-5-18(13)28(12)23(32)25-17-9-14-11-27(22(31)15(14)10-16(17)24)19-6-7-20(29)26-21(19)30/h2-5,9-10,12,19H,6-8,11H2,1H3,(H,25,32)(H,26,29,30) |
| InChIKey | LSHRUPSDHDJWGE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|