C23H21N7O4 — CID 175968747
2-(azidomethyl)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,3-dihydroindole-1-carboxamide (PubChem CID 175968747) has the molecular formula C23H21N7O4 and a molecular weight of 459.47 g/mol. Its IUPAC name is 2-(azidomethyl)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,3-dihydroindole-1-carboxamide.
| Compound Name | 2-(azidomethyl)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 175968747 |
| Molecular Formula | C23H21N7O4 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 2-(azidomethyl)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,3-dihydroindole-1-carboxamide |
| SMILES | [N-]=[N+]=NCC1Cc2ccccc2N1C(=O)Nc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H21N7O4/c24-28-25-11-16-10-13-3-1-2-4-18(13)30(16)23(34)26-15-5-6-17-14(9-15)12-29(22(17)33)19-7-8-20(31)27-21(19)32/h1-6,9,16,19H,7-8,10-12H2,(H,26,34)(H,27,31,32) |
| InChIKey | CVEBWEFIGCCARB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 147.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|