C20H22N6O5 — CID 166426770
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-5-methyl-6-oxo-2,5,7-triazaspiro[3.4]octane-2-carboxamide (PubChem CID 166426770) has the molecular formula C20H22N6O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-5-methyl-6-oxo-2,5,7-triazaspiro[3.4]octane-2-carboxamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-5-methyl-6-oxo-2,5,7-triazaspiro[3.4]octane-2-carboxamide |
|---|---|
| PubChem CID | 166426770 |
| Molecular Formula | C20H22N6O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-5-methyl-6-oxo-2,5,7-triazaspiro[3.4]octane-2-carboxamide |
| SMILES | CN1C(=O)NCC12CN(C(=O)Nc1ccc3c(c1)CN(C1CCC(=O)NC1=O)C3=O)C2 |
| InChI | InChI=1S/C20H22N6O5/c1-24-18(30)21-8-20(24)9-25(10-20)19(31)22-12-2-3-13-11(6-12)7-26(17(13)29)14-4-5-15(27)23-16(14)28/h2-3,6,14H,4-5,7-10H2,1H3,(H,21,30)(H,22,31)(H,23,27,28) |
| InChIKey | NMASODFABLAVRH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|