C8H10ClFN2OS — CID 166428005
2-chloro-N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-2-fluoroacetamide (PubChem CID 166428005) has the molecular formula C8H10ClFN2OS and a molecular weight of 236.70 g/mol. Its IUPAC name is 2-chloro-N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-2-fluoroacetamide.
| Compound Name | 2-chloro-N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-2-fluoroacetamide |
|---|---|
| PubChem CID | 166428005 |
| Molecular Formula | C8H10ClFN2OS |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 2-chloro-N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-2-fluoroacetamide |
| SMILES | Cc1nc(CNC(=O)C(F)Cl)c(C)s1 |
| InChI | InChI=1S/C8H10ClFN2OS/c1-4-6(12-5(2)14-4)3-11-8(13)7(9)10/h7H,3H2,1-2H3,(H,11,13) |
| InChIKey | RQAZYAPRIJMZJZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|