C19H14BrN3O4 — CID 166428452
N-(7-bromo-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 166428452) has the molecular formula C19H14BrN3O4 and a molecular weight of 428.24 g/mol. Its IUPAC name is N-(7-bromo-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(7-bromo-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 166428452 |
| Molecular Formula | C19H14BrN3O4 |
| Molecular Weight | 428.24 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | N-(7-bromo-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(NC1CCc2cc(Br)ccc2NC1=O)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C19H14BrN3O4/c20-11-3-6-14-9(7-11)2-5-15(19(27)21-14)22-16(24)10-1-4-12-13(8-10)18(26)23-17(12)25/h1,3-4,6-8,15H,2,5H2,(H,21,27)(H,22,24)(H,23,25,26) |
| InChIKey | VWYBLJQIOARQDD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|