C12H13ClFNO — CID 166430303
2-chloro-N-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]acetamide (PubChem CID 166430303) has the molecular formula C12H13ClFNO and a molecular weight of 241.69 g/mol. Its IUPAC name is 2-chloro-N-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 166430303 |
| Molecular Formula | C12H13ClFNO |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-chloro-N-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]acetamide |
| SMILES | O=C(CCl)NCc1ccc(F)c2c1CCC2 |
| InChI | InChI=1S/C12H13ClFNO/c13-6-12(16)15-7-8-4-5-11(14)10-3-1-2-9(8)10/h4-5H,1-3,6-7H2,(H,15,16) |
| InChIKey | KUARAWNXCFAGIV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|