C32H36N2O5 — CID 166437156
N-[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-3-phenyl-N-(3,4,5-trimethoxyphenyl)prop-2-ynamide (PubChem CID 166437156) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-3-phenyl-N-(3,4,5-trimethoxyphenyl)prop-2-ynamide.
| Compound Name | N-[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-3-phenyl-N-(3,4,5-trimethoxyphenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 166437156 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | N-[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-3-phenyl-N-(3,4,5-trimethoxyphenyl)prop-2-ynamide |
| SMILES | CCCCCNC(=O)C(c1ccc(C)cc1)N(C(=O)C#Cc1ccccc1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C32H36N2O5/c1-6-7-11-20-33-32(36)30(25-17-14-23(2)15-18-25)34(29(35)19-16-24-12-9-8-10-13-24)26-21-27(37-3)31(39-5)28(22-26)38-4/h8-10,12-15,17-18,21-22,30H,6-7,11,20H2,1-5H3,(H,33,36) |
| InChIKey | GSNILXNGZIRWML-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|