tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate

C10H17NO5S — CID 166437255

IUPACtert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate
SMILESCCCC1=NS(=O)(=O)OC1C(=O)OC(C)(C)C
InChIInChI=1S/C10H17NO5S/c1-5-6-7-8(16-17(13,14)11-7)9(12)15-10(2,3)4/h8H,5-6H2,1-4H3
InChIKeyXYTSIWPZLYELIA-UHFFFAOYSA-N
MW263.31 g/mol
LogP1.21
Rot. Bonds3

About tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate

tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate (PubChem CID 166437255) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate.

Molecular Properties

Compound Nametert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate
PubChem CID166437255
Molecular FormulaC10H17NO5S
Molecular Weight263.31 g/mol
Exact Mass263.08
IUPAC Nametert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate
SMILESCCCC1=NS(=O)(=O)OC1C(=O)OC(C)(C)C
InChIInChI=1S/C10H17NO5S/c1-5-6-7-8(16-17(13,14)11-7)9(12)15-10(2,3)4/h8H,5-6H2,1-4H3
InChIKeyXYTSIWPZLYELIA-UHFFFAOYSA-N
XLogP1.21
TPSA82.03 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.31
LogP ≤ 51.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate?
The IUPAC name of tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate (CID 166437255) is tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate.
What is the SMILES notation for tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate?
The canonical SMILES for tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate is CCCC1=NS(=O)(=O)OC1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate?
The InChIKey is XYTSIWPZLYELIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO5S/c1-5-6-7-8(16-17(13,14)11-7)9(12)15-10(2,3)4/h8H,5-6H2,1-4H3.
What are the key properties of tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate?
tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate has a molecular weight of 263.31 g/mol, XLogP of 1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,2-dioxo-4-propyl-5H-oxathiazole-5-carboxylate is sourced from PubChem (CID 166437255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).