C19H29BO4 — CID 166439773
1-[2-methyl-5-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-enyl]furan-3-yl]ethanone (PubChem CID 166439773) has the molecular formula C19H29BO4 and a molecular weight of 332.25 g/mol. Its IUPAC name is 1-[2-methyl-5-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-enyl]furan-3-yl]ethanone.
| Compound Name | 1-[2-methyl-5-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-enyl]furan-3-yl]ethanone |
|---|---|
| PubChem CID | 166439773 |
| Molecular Formula | C19H29BO4 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-[2-methyl-5-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-enyl]furan-3-yl]ethanone |
| SMILES | CCCC/C=C(\B1OC(C)(C)C(C)(C)O1)c1cc(C(C)=O)c(C)o1 |
| InChI | InChI=1S/C19H29BO4/c1-8-9-10-11-16(17-12-15(13(2)21)14(3)22-17)20-23-18(4,5)19(6,7)24-20/h11-12H,8-10H2,1-7H3/b16-11- |
| InChIKey | BJLIKJQNZKCRPY-WJDWOHSUSA-N |
| XLogP | 5.00 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|