C16H18F3NO3 — CID 166442987
(3R)-3-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)-2-oxaspiro[4.4]nonane (PubChem CID 166442987) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is (3R)-3-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)-2-oxaspiro[4.4]nonane.
| Compound Name | (3R)-3-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)-2-oxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 166442987 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (3R)-3-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)-2-oxaspiro[4.4]nonane |
| SMILES | O=[N+]([O-])c1cccc([C@]2(CC(F)(F)F)CC3(CCCC3)CO2)c1 |
| InChI | InChI=1S/C16H18F3NO3/c17-16(18,19)10-15(9-14(11-23-15)6-1-2-7-14)12-4-3-5-13(8-12)20(21)22/h3-5,8H,1-2,6-7,9-11H2/t15-/m1/s1 |
| InChIKey | GXSRAJCDIFEJAE-OAHLLOKOSA-N |
| XLogP | 4.72 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|