C16H16F3NO6S — CID 166444380
dimethyl (2Z,4E)-3-[[2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate (PubChem CID 166444380) has the molecular formula C16H16F3NO6S and a molecular weight of 407.37 g/mol. Its IUPAC name is dimethyl (2Z,4E)-3-[[2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate.
| Compound Name | dimethyl (2Z,4E)-3-[[2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 166444380 |
| Molecular Formula | C16H16F3NO6S |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | dimethyl (2Z,4E)-3-[[2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate |
| SMILES | COC(=O)/C=C(\C=C\C(=O)OC)Cc1ccccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H16F3NO6S/c1-25-14(21)8-7-11(10-15(22)26-2)9-12-5-3-4-6-13(12)20-27(23,24)16(17,18)19/h3-8,10,20H,9H2,1-2H3/b8-7+,11-10+ |
| InChIKey | ZRMBBUHVZZHUAK-ZDVGBALWSA-N |
| XLogP | 2.32 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|