C20H21FN2O2 — CID 166446606
tert-butyl N-[2-(10-fluorophenanthridin-6-yl)ethyl]carbamate (PubChem CID 166446606) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is tert-butyl N-[2-(10-fluorophenanthridin-6-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(10-fluorophenanthridin-6-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 166446606 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | tert-butyl N-[2-(10-fluorophenanthridin-6-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1nc2ccccc2c2c(F)cccc12 |
| InChI | InChI=1S/C20H21FN2O2/c1-20(2,3)25-19(24)22-12-11-17-14-8-6-9-15(21)18(14)13-7-4-5-10-16(13)23-17/h4-10H,11-12H2,1-3H3,(H,22,24) |
| InChIKey | RGWXLUJMLJGLMV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|