C31H28N2O4 — CID 166447309
benzyl 3,3-bis[(3aR)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]butanoate (PubChem CID 166447309) has the molecular formula C31H28N2O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is benzyl 3,3-bis[(3aR)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]butanoate.
| Compound Name | benzyl 3,3-bis[(3aR)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]butanoate |
|---|---|
| PubChem CID | 166447309 |
| Molecular Formula | C31H28N2O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | benzyl 3,3-bis[(3aR)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]butanoate |
| SMILES | CC(CC(=O)OCc1ccccc1)(C1=NC2c3ccccc3C[C@H]2O1)C1=NC2c3ccccc3C[C@H]2O1 |
| InChI | InChI=1S/C31H28N2O4/c1-31(17-26(34)35-18-19-9-3-2-4-10-19,29-32-27-22-13-7-5-11-20(22)15-24(27)36-29)30-33-28-23-14-8-6-12-21(23)16-25(28)37-30/h2-14,24-25,27-28H,15-18H2,1H3/t24-,25-,27?,28?,31?/m1/s1 |
| InChIKey | OCXDWNUEDSMYOR-SSAJNQJTSA-N |
| XLogP | 5.32 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |