C12H16O2S — CID 166448507
(4R)-2,2-dimethyl-4-(4-methylphenyl)sulfanyl-1,3-dioxolane (PubChem CID 166448507) has the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-(4-methylphenyl)sulfanyl-1,3-dioxolane.
| Compound Name | (4R)-2,2-dimethyl-4-(4-methylphenyl)sulfanyl-1,3-dioxolane |
|---|---|
| PubChem CID | 166448507 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (4R)-2,2-dimethyl-4-(4-methylphenyl)sulfanyl-1,3-dioxolane |
| SMILES | Cc1ccc(S[C@@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C12H16O2S/c1-9-4-6-10(7-5-9)15-11-8-13-12(2,3)14-11/h4-7,11H,8H2,1-3H3/t11-/m1/s1 |
| InChIKey | VXJROANGWAVASB-LLVKDONJSA-N |
| XLogP | 3.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |