C33H36O5 — CID 166448543
(1R,2S,3R,4S)-1-[2,4-bis(phenylmethoxy)phenyl]-4-(4-methoxyphenyl)-2,3-dimethylbutane-1,4-diol (PubChem CID 166448543) has the molecular formula C33H36O5 and a molecular weight of 512.65 g/mol. Its IUPAC name is (1R,2S,3R,4S)-1-[2,4-bis(phenylmethoxy)phenyl]-4-(4-methoxyphenyl)-2,3-dimethylbutane-1,4-diol.
| Compound Name | (1R,2S,3R,4S)-1-[2,4-bis(phenylmethoxy)phenyl]-4-(4-methoxyphenyl)-2,3-dimethylbutane-1,4-diol |
|---|---|
| PubChem CID | 166448543 |
| Molecular Formula | C33H36O5 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | (1R,2S,3R,4S)-1-[2,4-bis(phenylmethoxy)phenyl]-4-(4-methoxyphenyl)-2,3-dimethylbutane-1,4-diol |
| SMILES | COc1ccc([C@@H](O)[C@H](C)[C@H](C)[C@@H](O)c2ccc(OCc3ccccc3)cc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H36O5/c1-23(32(34)27-14-16-28(36-3)17-15-27)24(2)33(35)30-19-18-29(37-21-25-10-6-4-7-11-25)20-31(30)38-22-26-12-8-5-9-13-26/h4-20,23-24,32-35H,21-22H2,1-3H3/t23-,24+,32+,33-/m1/s1 |
| InChIKey | VGQVAOWPNPHPSS-CKRUJBHZSA-N |
| XLogP | 6.89 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |