C24H25NO3S — CID 11122374
2-[2,4-bis(phenylmethoxy)phenyl]-2-hydroxy-N,N-dimethylethanethioamide (PubChem CID 11122374) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-[2,4-bis(phenylmethoxy)phenyl]-2-hydroxy-N,N-dimethylethanethioamide.
| Compound Name | 2-[2,4-bis(phenylmethoxy)phenyl]-2-hydroxy-N,N-dimethylethanethioamide |
|---|---|
| PubChem CID | 11122374 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-[2,4-bis(phenylmethoxy)phenyl]-2-hydroxy-N,N-dimethylethanethioamide |
| SMILES | CN(C)C(=S)C(O)c1ccc(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H25NO3S/c1-25(2)24(29)23(26)21-14-13-20(27-16-18-9-5-3-6-10-18)15-22(21)28-17-19-11-7-4-8-12-19/h3-15,23,26H,16-17H2,1-2H3 |
| InChIKey | DMOCHSBAZTYQFJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|